C21H22N2O9 — CID 95566287
(4S,4aR,5S,5aS,6R,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 95566287) has the molecular formula C21H22N2O9 and a molecular weight of 446.41 g/mol. Its IUPAC name is (4S,4aR,5S,5aS,6R,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aS,6R,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 95566287 |
| Molecular Formula | C21H22N2O9 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (4S,4aR,5S,5aS,6R,12aR)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](O)[C@@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C21H22N2O9/c1-23(2)13-12-16(27)9-10(15(26)8-6(14(9)25)4-3-5-7(8)24)18(29)21(12,32)19(30)11(17(13)28)20(22)31/h3-5,9,12-14,16,24-27,30,32H,1-2H3,(H2,22,31)/t9-,12-,13+,14+,16+,21+/m1/s1 |
| InChIKey | VIIXGCAKWGZFBD-GFVCRYCESA-N |
| XLogP | -1.57 |
| TPSA | 201.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|