C26H32N2O8S — CID 54721385
(4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(2-methylpropylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54721385) has the molecular formula C26H32N2O8S and a molecular weight of 532.62 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(2-methylpropylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(2-methylpropylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54721385 |
| Molecular Formula | C26H32N2O8S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(2-methylpropylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)CSC[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C26H32N2O8S/c1-10(2)8-37-9-12-11-6-5-7-13(29)14(11)20(30)16-15(12)21(31)18-19(28(3)4)22(32)17(25(27)35)24(34)26(18,36)23(16)33/h5-7,10,12,15,18-19,21,29-31,34,36H,8-9H2,1-4H3,(H2,27,35)/t12-,15?,18?,19-,21?,26-/m0/s1 |
| InChIKey | MNUDJAJDAHBATO-JLULKMJMSA-N |
| XLogP | 0.87 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|