C29H30N2O8 — CID 118504996
4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-[(3-methylphenyl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118504996) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-[(3-methylphenyl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-[(3-methylphenyl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118504996 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-[(3-methylphenyl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1cccc(CC2c3cccc(O)c3C(O)=C3C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4C(O)C32)c1 |
| InChI | InChI=1S/C29H30N2O8/c1-12-6-4-7-13(10-12)11-15-14-8-5-9-16(32)17(14)23(33)19-18(15)24(34)21-22(31(2)3)25(35)20(28(30)38)27(37)29(21,39)26(19)36/h4-10,15,18,21-22,24,32-34,37,39H,11H2,1-3H3,(H2,30,38) |
| InChIKey | ZUSREECUDPKCJC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|