C24H30N2O8 — CID 91607600
(12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane (PubChem CID 91607600) has the molecular formula C24H30N2O8 and a molecular weight of 474.51 g/mol. Its IUPAC name is (12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane.
| Compound Name | (12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 91607600 |
| Molecular Formula | C24H30N2O8 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane |
| SMILES | CC.CC1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C22H24N2O8.C2H6/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;1-2/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31);1-2H3/t7?,10?,14?,15?,17?,22-;/m0./s1 |
| InChIKey | WZFMKLAEOLAWJW-XXXZQDAZSA-N |
| XLogP | 0.52 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|