C22H24N2O11S — CID 170454549
[(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] hydrogen sulfate (PubChem CID 170454549) has the molecular formula C22H24N2O11S and a molecular weight of 524.50 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] hydrogen sulfate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170454549 |
| Molecular Formula | C22H24N2O11S |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] hydrogen sulfate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](OS(=O)(=O)O)[C@@H]21 |
| InChI | InChI=1S/C22H24N2O11S/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)18(35-36(32,33)34)14-15(24(2)3)17(27)13(21(23)30)20(29)22(14,31)19(12)28/h4-7,10,14-15,18,25-26,29,31H,1-3H3,(H2,23,30)(H,32,33,34)/t7-,10+,14+,15-,18-,22-/m0/s1 |
| InChIKey | FOVJUETYLMFVGB-LURCGAPJSA-N |
| XLogP | -0.68 |
| TPSA | 224.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|