C27H33N3O9 — CID 140958610
[(4R,4aR,5R,5aS,6R,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-tert-butylcarbamate (PubChem CID 140958610) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is [(4R,4aR,5R,5aS,6R,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-tert-butylcarbamate.
| Compound Name | [(4R,4aR,5R,5aS,6R,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140958610 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [(4R,4aR,5R,5aS,6R,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-tert-butylcarbamate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@@]3(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@@H]3[C@H](OC(=O)NC(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C27H33N3O9/c1-10-11-8-7-9-12(31)14(11)19(32)15-13(10)21(39-25(37)29-26(2,3)4)17-18(30(5)6)20(33)16(24(28)36)23(35)27(17,38)22(15)34/h7-10,13,17-18,21,31-32,35,38H,1-6H3,(H2,28,36)(H,29,37)/t10-,13-,17+,18+,21+,27+/m0/s1 |
| InChIKey | QLUWFMMHCDFOCY-ZVRKWPGISA-N |
| XLogP | 1.03 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|