C29H34N2O9 — CID 54719044
[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-cyclopentylacetate (PubChem CID 54719044) has the molecular formula C29H34N2O9 and a molecular weight of 554.60 g/mol. Its IUPAC name is [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-cyclopentylacetate.
| Compound Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 54719044 |
| Molecular Formula | C29H34N2O9 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-cyclopentylacetate |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(OC(=O)CC3CCCC3)C21 |
| InChI | InChI=1S/C29H34N2O9/c1-12-14-9-6-10-15(32)18(14)23(34)19-17(12)25(40-16(33)11-13-7-4-5-8-13)21-22(31(2)3)24(35)20(28(30)38)27(37)29(21,39)26(19)36/h6,9-10,12-13,17,21-22,25,32,34,37,39H,4-5,7-8,11H2,1-3H3,(H2,30,38) |
| InChIKey | LCNSCXNWYLNBQU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|