C26H28N2O9 — CID 137475735
[(4S,4aR,5S,5aR,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopropanecarboxylate (PubChem CID 137475735) has the molecular formula C26H28N2O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopropanecarboxylate.
| Compound Name | [(4S,4aR,5S,5aR,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 137475735 |
| Molecular Formula | C26H28N2O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [(4S,4aR,5S,5aR,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopropanecarboxylate |
| SMILES | C[C@@H]1c2cccc(O)c2C(O)=C2C(=O)[C@@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](OC(=O)C3CC3)[C@@H]21 |
| InChI | InChI=1S/C26H28N2O9/c1-9-11-5-4-6-12(29)14(11)19(30)15-13(9)21(37-25(35)10-7-8-10)17-18(28(2)3)20(31)16(24(27)34)23(33)26(17,36)22(15)32/h4-6,9-10,13,17-18,21,29-30,33,36H,7-8H2,1-3H3,(H2,27,34)/t9-,13-,17-,18+,21+,26-/m1/s1 |
| InChIKey | RAQRQDCSGACZNN-YJEIBZEISA-N |
| XLogP | 0.46 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|