C30H36N2O9 — CID 59978843
[(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cycloheptanecarboxylate (PubChem CID 59978843) has the molecular formula C30H36N2O9 and a molecular weight of 568.62 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cycloheptanecarboxylate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cycloheptanecarboxylate |
|---|---|
| PubChem CID | 59978843 |
| Molecular Formula | C30H36N2O9 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cycloheptanecarboxylate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](OC(=O)C3CCCCCC3)[C@@H]21 |
| InChI | InChI=1S/C30H36N2O9/c1-13-15-11-8-12-16(33)18(15)23(34)19-17(13)25(41-29(39)14-9-6-4-5-7-10-14)21-22(32(2)3)24(35)20(28(31)38)27(37)30(21,40)26(19)36/h8,11-14,17,21-22,25,33-34,37,40H,4-7,9-10H2,1-3H3,(H2,31,38)/t13-,17+,21+,22-,25-,30-/m0/s1 |
| InChIKey | WEKJDAGSVXJOHO-VCUVURMISA-N |
| XLogP | 2.02 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|