C29H29N3O9 — CID 137475969
[(4S,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-phenylcarbamate (PubChem CID 137475969) has the molecular formula C29H29N3O9 and a molecular weight of 563.56 g/mol. Its IUPAC name is [(4S,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-phenylcarbamate.
| Compound Name | [(4S,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 137475969 |
| Molecular Formula | C29H29N3O9 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [(4S,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] N-phenylcarbamate |
| SMILES | C[C@@H]1c2cccc(O)c2C(O)=C2C(=O)[C@@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@H]3[C@H](OC(=O)Nc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C29H29N3O9/c1-12-14-10-7-11-15(33)17(14)22(34)18-16(12)24(41-28(39)31-13-8-5-4-6-9-13)20-21(32(2)3)23(35)19(27(30)38)26(37)29(20,40)25(18)36/h4-12,16,20-21,24,33-34,37,40H,1-3H3,(H2,30,38)(H,31,39)/t12-,16+,20+,21+,24-,29-/m1/s1 |
| InChIKey | LHTBRISEZIHRMH-MSVOCNMPSA-N |
| XLogP | 1.75 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|