C33H38N2O9 — CID 54680935
[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] adamantane-1-carboxylate (PubChem CID 54680935) has the molecular formula C33H38N2O9 and a molecular weight of 606.67 g/mol. Its IUPAC name is [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] adamantane-1-carboxylate.
| Compound Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 54680935 |
| Molecular Formula | C33H38N2O9 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] adamantane-1-carboxylate |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(OC(=O)C34CC5CC(CC(C5)C3)C4)C21 |
| InChI | InChI=1S/C33H38N2O9/c1-13-17-5-4-6-18(36)20(17)25(37)21-19(13)27(44-31(42)32-10-14-7-15(11-32)9-16(8-14)12-32)23-24(35(2)3)26(38)22(30(34)41)29(40)33(23,43)28(21)39/h4-6,13-16,19,23-24,27,36-37,40,43H,7-12H2,1-3H3,(H2,34,41) |
| InChIKey | GMNOGRHLTATEII-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|