C26H31N3O9 — CID 54719052
[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-(dimethylamino)acetate (PubChem CID 54719052) has the molecular formula C26H31N3O9 and a molecular weight of 529.55 g/mol. Its IUPAC name is [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-(dimethylamino)acetate.
| Compound Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 54719052 |
| Molecular Formula | C26H31N3O9 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-(dimethylamino)acetate |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(OC(=O)CN(C)C)C21 |
| InChI | InChI=1S/C26H31N3O9/c1-10-11-7-6-8-12(30)15(11)20(32)16-14(10)22(38-13(31)9-28(2)3)18-19(29(4)5)21(33)17(25(27)36)24(35)26(18,37)23(16)34/h6-8,10,14,18-19,22,30,32,35,37H,9H2,1-5H3,(H2,27,36) |
| InChIKey | PGGFZKIQCWNQSN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|