C28H32N2O9 — CID 59978840
[(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopentanecarboxylate (PubChem CID 59978840) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopentanecarboxylate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 59978840 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] cyclopentanecarboxylate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](OC(=O)C3CCCC3)[C@@H]21 |
| InChI | InChI=1S/C28H32N2O9/c1-11-13-9-6-10-14(31)16(13)21(32)17-15(11)23(39-27(37)12-7-4-5-8-12)19-20(30(2)3)22(33)18(26(29)36)25(35)28(19,38)24(17)34/h6,9-12,15,19-20,23,31-32,35,38H,4-5,7-8H2,1-3H3,(H2,29,36)/t11-,15+,19+,20-,23-,28-/m0/s1 |
| InChIKey | SBZDEPVYVQWWHV-AGUQABAASA-N |
| XLogP | 1.24 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|