C27H32N2O9 — CID 54680963
[4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-2-(methylcarbamoyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-methylpropanoate (PubChem CID 54680963) has the molecular formula C27H32N2O9 and a molecular weight of 528.56 g/mol. Its IUPAC name is [4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-2-(methylcarbamoyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-methylpropanoate.
| Compound Name | [4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-2-(methylcarbamoyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 54680963 |
| Molecular Formula | C27H32N2O9 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-2-(methylcarbamoyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-methylpropanoate |
| SMILES | CNC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)C3C(OC(=O)C(C)C)C2C(N(C)C)C1=O |
| InChI | InChI=1S/C27H32N2O9/c1-10(2)26(36)38-22-14-11(3)12-8-7-9-13(30)15(12)20(31)16(14)23(33)27(37)18(22)19(29(5)6)21(32)17(24(27)34)25(35)28-4/h7-11,14,18-19,22,30-31,34,37H,1-6H3,(H,28,35) |
| InChIKey | WUFIWDADBAZIFO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 173.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|