C25H30N2O9 — CID 137476420
(4S,4aR,5S,5aR,6R,12aR)-N-tert-butyl-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137476420) has the molecular formula C25H30N2O9 and a molecular weight of 502.52 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aR)-N-tert-butyl-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aR)-N-tert-butyl-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137476420 |
| Molecular Formula | C25H30N2O9 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-N-tert-butyl-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(=O)NC(C)(C)C)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](O)[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C25H30N2O9/c1-24(2,3)26-23(35)14-20(32)16(27(4)5)15-19(31)12-13(21(33)25(15,36)22(14)34)18(30)11-9(17(12)29)7-6-8-10(11)28/h6-8,12,15-17,19,28-31,34,36H,1-5H3,(H,26,35)/t12-,15+,16-,17-,19-,25-/m0/s1 |
| InChIKey | QFLIKTGFPVLPCL-LYQYPBGSSA-N |
| XLogP | -0.14 |
| TPSA | 187.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|