C29H37NO8 — CID 123677429
(1S,4aR,11R,11aR,12S,12aR)-1-(dimethylamino)-3-(3,3-dimethylhexanoyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 123677429) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is (1S,4aR,11R,11aR,12S,12aR)-1-(dimethylamino)-3-(3,3-dimethylhexanoyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11R,11aR,12S,12aR)-1-(dimethylamino)-3-(3,3-dimethylhexanoyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 123677429 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (1S,4aR,11R,11aR,12S,12aR)-1-(dimethylamino)-3-(3,3-dimethylhexanoyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CCCC(C)(C)CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](C)[C@H]3[C@H](O)[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C29H37NO8/c1-7-11-28(3,4)12-16(32)19-25(35)22(30(5)6)21-24(34)17-13(2)14-9-8-10-15(31)18(14)23(33)20(17)27(37)29(21,38)26(19)36/h8-10,13,17,21-22,24,31,33-34,36,38H,7,11-12H2,1-6H3/t13-,17+,21+,22-,24-,29+/m0/s1 |
| InChIKey | FPUNCZAGYMPJTM-CMZRBICISA-N |
| XLogP | 2.80 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|