C27H33N3O11 — CID 126574828
2-[[3-[(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-2-yl]-3-oxopropyl]-methylamino]ethyl nitrate (PubChem CID 126574828) has the molecular formula C27H33N3O11 and a molecular weight of 575.57 g/mol. Its IUPAC name is 2-[[3-[(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-2-yl]-3-oxopropyl]-methylamino]ethyl nitrate.
| Compound Name | 2-[[3-[(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-2-yl]-3-oxopropyl]-methylamino]ethyl nitrate |
|---|---|
| PubChem CID | 126574828 |
| Molecular Formula | C27H33N3O11 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[[3-[(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-2-yl]-3-oxopropyl]-methylamino]ethyl nitrate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(=O)CCN(C)CCO[N+](=O)[O-])C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C27H33N3O11/c1-12-13-6-5-7-14(31)17(13)22(33)19-16(12)23(34)20-21(28(2)3)24(35)18(25(36)27(20,38)26(19)37)15(32)8-9-29(4)10-11-41-30(39)40/h5-7,12,16,20-21,23,31,33-34,36,38H,8-11H2,1-4H3/t12-,16+,20+,21-,23-,27+/m0/s1 |
| InChIKey | LWEZAQVXZYYQAH-FOYMRMAKSA-N |
| XLogP | 0.11 |
| TPSA | 211.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|