C27H33N5O14 — CID 167147102
2-[[[4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]amino]methyl-(2-nitrooxyethyl)amino]ethyl nitrate (PubChem CID 167147102) has the molecular formula C27H33N5O14 and a molecular weight of 651.58 g/mol. Its IUPAC name is 2-[[[4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]amino]methyl-(2-nitrooxyethyl)amino]ethyl nitrate.
| Compound Name | 2-[[[4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]amino]methyl-(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| PubChem CID | 167147102 |
| Molecular Formula | C27H33N5O14 |
| Molecular Weight | 651.58 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | 2-[[[4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carbonyl]amino]methyl-(2-nitrooxyethyl)amino]ethyl nitrate |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(=O)NCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-])C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C27H33N5O14/c1-12-13-5-4-6-14(33)16(13)21(34)17-15(12)22(35)19-20(29(2)3)23(36)18(25(38)27(19,40)24(17)37)26(39)28-11-30(7-9-45-31(41)42)8-10-46-32(43)44/h4-6,12,15,19-20,22,33-35,38,40H,7-11H2,1-3H3,(H,28,39) |
| InChIKey | JWPYVINTVRPVIM-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 275.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.58 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|