C28H35BrN2O7 — CID 59984318
(4R,4aS,5R,5aS,6S,12aR)-3-bromo-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-N-(2-methylpentan-2-yl)-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59984318) has the molecular formula C28H35BrN2O7 and a molecular weight of 591.50 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-3-bromo-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-N-(2-methylpentan-2-yl)-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-3-bromo-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-N-(2-methylpentan-2-yl)-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59984318 |
| Molecular Formula | C28H35BrN2O7 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-3-bromo-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-N-(2-methylpentan-2-yl)-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCC(C)(C)NC(=O)C1=C(Br)[C@H](N(C)C)[C@H]2[C@H](O)[C@@H]3C(=C(O)c4c(O)cccc4[C@H]3C)C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C28H35BrN2O7/c1-7-11-27(3,4)30-26(37)18-20(29)21(31(5)6)19-23(34)15-12(2)13-9-8-10-14(32)16(13)22(33)17(15)24(35)28(19,38)25(18)36/h8-10,12,15,19,21,23,32-34,38H,7,11H2,1-6H3,(H,30,37)/t12-,15+,19+,21-,23-,28-/m1/s1 |
| InChIKey | KIDJQSRYRUOMDS-POWNTQPWSA-N |
| XLogP | 2.54 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|