C27H29BrN2O7 — CID 59984338
(4R,4aS,5R,5aS,6S,12aR)-3-bromo-9-cyclopent-2-en-1-yl-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59984338) has the molecular formula C27H29BrN2O7 and a molecular weight of 573.44 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,6S,12aR)-3-bromo-9-cyclopent-2-en-1-yl-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,6S,12aR)-3-bromo-9-cyclopent-2-en-1-yl-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59984338 |
| Molecular Formula | C27H29BrN2O7 |
| Molecular Weight | 573.44 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | (4R,4aS,5R,5aS,6S,12aR)-3-bromo-9-cyclopent-2-en-1-yl-4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@@H]1c2ccc(C3C=CCC3)c(O)c2C(O)=C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)=C(Br)[C@H](N(C)C)[C@H]3[C@H](O)[C@H]21 |
| InChI | InChI=1S/C27H29BrN2O7/c1-10-12-8-9-13(11-6-4-5-7-11)21(31)15(12)22(32)16-14(10)23(33)18-20(30(2)3)19(28)17(26(29)36)25(35)27(18,37)24(16)34/h4,6,8-11,14,18,20,23,31-33,37H,5,7H2,1-3H3,(H2,29,36)/t10-,11?,14+,18+,20-,23-,27-/m1/s1 |
| InChIKey | RHYIWQJJAHMXHZ-FNUIIOEASA-N |
| XLogP | 1.77 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|