C36H37N3O8 — CID 54719236
9-(dibenzylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719236) has the molecular formula C36H37N3O8 and a molecular weight of 639.71 g/mol. Its IUPAC name is 9-(dibenzylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(dibenzylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719236 |
| Molecular Formula | C36H37N3O8 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 9-(dibenzylamino)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(N(Cc3ccccc3)Cc3ccccc3)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C36H37N3O8/c1-18-21-14-15-22(39(16-19-10-6-4-7-11-19)17-20-12-8-5-9-13-20)29(40)24(21)30(41)25-23(18)31(42)27-28(38(2)3)32(43)26(35(37)46)34(45)36(27,47)33(25)44/h4-15,18,23,27-28,31,40-42,45,47H,16-17H2,1-3H3,(H2,37,46) |
| InChIKey | MGYKLMUCBFUMKQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|