C32H36N4O9 — CID 67550711
(4S)-4-(dimethylamino)-9-[[2-(dimethylamino)-2-phenylacetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67550711) has the molecular formula C32H36N4O9 and a molecular weight of 620.66 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-9-[[2-(dimethylamino)-2-phenylacetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-9-[[2-(dimethylamino)-2-phenylacetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67550711 |
| Molecular Formula | C32H36N4O9 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | (4S)-4-(dimethylamino)-9-[[2-(dimethylamino)-2-phenylacetyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(NC(=O)C(c3ccccc3)N(C)C)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C32H36N4O9/c1-13-15-11-12-16(34-31(44)22(35(2)3)14-9-7-6-8-10-14)24(37)18(15)25(38)19-17(13)26(39)21-23(36(4)5)27(40)20(30(33)43)29(42)32(21,45)28(19)41/h6-13,17,21-23,26,37-39,42,45H,1-5H3,(H2,33,43)(H,34,44)/t13?,17?,21?,22?,23-,26?,32?/m0/s1 |
| InChIKey | NEDJXHSCVLOXPT-MWOCCCEKSA-N |
| XLogP | 0.74 |
| TPSA | 213.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|