C25H28BrN3O10 — CID 67550853
(4S)-9-[(2-bromo-3-hydroxypropanoyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67550853) has the molecular formula C25H28BrN3O10 and a molecular weight of 610.41 g/mol. Its IUPAC name is (4S)-9-[(2-bromo-3-hydroxypropanoyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S)-9-[(2-bromo-3-hydroxypropanoyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67550853 |
| Molecular Formula | C25H28BrN3O10 |
| Molecular Weight | 610.41 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | (4S)-9-[(2-bromo-3-hydroxypropanoyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(NC(=O)C(Br)CO)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C25H28BrN3O10/c1-7-8-4-5-10(28-24(38)9(26)6-30)17(31)12(8)18(32)13-11(7)19(33)15-16(29(2)3)20(34)14(23(27)37)22(36)25(15,39)21(13)35/h4-5,7,9,11,15-16,19,30-33,36,39H,6H2,1-3H3,(H2,27,37)(H,28,38)/t7?,9?,11?,15?,16-,19?,25?/m0/s1 |
| InChIKey | FQHVTNBLAUGYAH-TWQVDODCSA-N |
| XLogP | -0.81 |
| TPSA | 230.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|