C25H30N4O9 — CID 67551143
(4S,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67551143) has the molecular formula C25H30N4O9 and a molecular weight of 530.53 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67551143 |
| Molecular Formula | C25H30N4O9 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNCC(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C1C2C |
| InChI | InChI=1S/C25H30N4O9/c1-8-9-5-6-10(28-11(30)7-27-2)18(31)13(9)19(32)14-12(8)20(33)16-17(29(3)4)21(34)15(24(26)37)23(36)25(16,38)22(14)35/h5-6,8,12,16-17,20,27,31-33,36,38H,7H2,1-4H3,(H2,26,37)(H,28,30)/t8?,12?,16?,17-,20?,25-/m0/s1 |
| InChIKey | AKIUHWPGSQVERG-CIJJOXOISA-N |
| XLogP | -1.35 |
| TPSA | 222.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|