C24H27Cl2N3O9 — CID 67550582
(4S)-9-[(2-chloroacetyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (PubChem CID 67550582) has the molecular formula C24H27Cl2N3O9 and a molecular weight of 572.40 g/mol. Its IUPAC name is (4S)-9-[(2-chloroacetyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride.
| Compound Name | (4S)-9-[(2-chloroacetyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67550582 |
| Molecular Formula | C24H27Cl2N3O9 |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (4S)-9-[(2-chloroacetyl)amino]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| SMILES | CC1c2ccc(NC(=O)CCl)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21.Cl |
| InChI | InChI=1S/C24H26ClN3O9.ClH/c1-7-8-4-5-9(27-10(29)6-25)17(30)12(8)18(31)13-11(7)19(32)15-16(28(2)3)20(33)14(23(26)36)22(35)24(15,37)21(13)34;/h4-5,7,11,15-16,19,30-32,35,37H,6H2,1-3H3,(H2,26,36)(H,27,29);1H/t7?,11?,15?,16-,19?,24?;/m0./s1 |
| InChIKey | ZNSWXMJBFAWNCQ-CIZCVSBRSA-N |
| XLogP | 0.09 |
| TPSA | 210.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|