C25H25NO8 — CID 54722823
9-cyclopent-2-en-1-yl-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722823) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is 9-cyclopent-2-en-1-yl-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-cyclopent-2-en-1-yl-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722823 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 9-cyclopent-2-en-1-yl-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(C3C=CCC3)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C21 |
| InChI | InChI=1S/C25H25NO8/c1-9-11-6-7-12(10-4-2-3-5-10)19(28)16(11)21(30)18-15(9)20(29)13-8-14(27)17(24(26)33)22(31)25(13,34)23(18)32/h2,4,6-7,9-10,13,15,20,28-31,34H,3,5,8H2,1H3,(H2,26,33) |
| InChIKey | LYALOHIQGWMJCC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|