C20H19ClN2O8 — CID 54716055
(4aR,5R,5aR,6R,12aR)-9-amino-8-chloro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54716055) has the molecular formula C20H19ClN2O8 and a molecular weight of 450.83 g/mol. Its IUPAC name is (4aR,5R,5aR,6R,12aR)-9-amino-8-chloro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5R,5aR,6R,12aR)-9-amino-8-chloro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54716055 |
| Molecular Formula | C20H19ClN2O8 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (4aR,5R,5aR,6R,12aR)-9-amino-8-chloro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2cc(Cl)c(N)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H19ClN2O8/c1-4-5-2-7(21)13(22)16(27)10(5)15(26)12-9(4)14(25)6-3-8(24)11(19(23)30)17(28)20(6,31)18(12)29/h2,4,6,9,14,25-28,31H,3,22H2,1H3,(H2,23,30)/t4-,6+,9+,14-,20+/m0/s1 |
| InChIKey | NCMOBIYDWIRBAF-WYVLSEKTSA-N |
| XLogP | 0.19 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|