C20H21N3O8 — CID 54715689
(4aR,5R,5aR,6S,12aR)-7,9-diamino-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54715689) has the molecular formula C20H21N3O8 and a molecular weight of 431.40 g/mol. Its IUPAC name is (4aR,5R,5aR,6S,12aR)-7,9-diamino-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5R,5aR,6S,12aR)-7,9-diamino-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54715689 |
| Molecular Formula | C20H21N3O8 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (4aR,5R,5aR,6S,12aR)-7,9-diamino-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@@H]1c2c(N)cc(N)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H21N3O8/c1-4-9-6(21)3-7(22)15(26)12(9)16(27)13-10(4)14(25)5-2-8(24)11(19(23)30)17(28)20(5,31)18(13)29/h3-5,10,14,25-28,31H,2,21-22H2,1H3,(H2,23,30)/t4-,5-,10-,14+,20-/m1/s1 |
| InChIKey | JXOHCASYNAERLG-UUSMHGQSSA-N |
| XLogP | -0.88 |
| TPSA | 230.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|