C20H18N3O8+ — CID 54713714
(6aR,10aR,11R,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracene-1-diazonium (PubChem CID 54713714) has the molecular formula C20H18N3O8+ and a molecular weight of 428.38 g/mol. Its IUPAC name is (6aR,10aR,11R,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracene-1-diazonium.
| Compound Name | (6aR,10aR,11R,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracene-1-diazonium |
|---|---|
| PubChem CID | 54713714 |
| Molecular Formula | C20H18N3O8+ |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (6aR,10aR,11R,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracene-1-diazonium |
| SMILES | C[C@H]1c2c([N+]#N)ccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H17N3O8/c1-5-10-7(23-22)2-3-8(24)12(10)16(27)14-11(5)15(26)6-4-9(25)13(19(21)30)17(28)20(6,31)18(14)29/h2-3,5-6,11,15,26,31H,4H2,1H3,(H4-,21,24,25,27,28,29,30)/p+1/t5-,6+,11+,15-,20+/m0/s1 |
| InChIKey | PJDSDZLMNXSSLQ-ZDTVCRJGSA-O |
| XLogP | 0.44 |
| TPSA | 206.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|