C20H18N4O8 — CID 54715693
(4aR,5R,5aR,6S,12aR)-7-azido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54715693) has the molecular formula C20H18N4O8 and a molecular weight of 442.38 g/mol. Its IUPAC name is (4aR,5R,5aR,6S,12aR)-7-azido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5R,5aR,6S,12aR)-7-azido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54715693 |
| Molecular Formula | C20H18N4O8 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (4aR,5R,5aR,6S,12aR)-7-azido-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@@H]1c2c(N=[N+]=[N-])ccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H18N4O8/c1-5-10-7(23-24-22)2-3-8(25)12(10)16(28)14-11(5)15(27)6-4-9(26)13(19(21)31)17(29)20(6,32)18(14)30/h2-3,5-6,11,15,25,27-29,32H,4H2,1H3,(H2,21,31)/t5-,6-,11-,15+,20-/m1/s1 |
| InChIKey | MXDFWKYIDGYCHC-VZETWLQOSA-N |
| XLogP | 0.90 |
| TPSA | 227.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|