C20H18N3O9+ — CID 161139930
[(6aR,10aR,11S,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]imino-oxoazanium (PubChem CID 161139930) has the molecular formula C20H18N3O9+ and a molecular weight of 444.38 g/mol. Its IUPAC name is [(6aR,10aR,11S,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]imino-oxoazanium.
| Compound Name | [(6aR,10aR,11S,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]imino-oxoazanium |
|---|---|
| PubChem CID | 161139930 |
| Molecular Formula | C20H18N3O9+ |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [(6aR,10aR,11S,11aR,12R)-8-carbamoyl-4,5,6a,7,11-pentahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]imino-oxoazanium |
| SMILES | C[C@H]1c2c(N=[N+]=O)ccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H17N3O9/c1-5-10-7(22-23-32)2-3-8(24)12(10)16(27)14-11(5)15(26)6-4-9(25)13(19(21)30)17(28)20(6,31)18(14)29/h2-3,5-6,11,15,26,31H,4H2,1H3,(H4,21,25,27,28,29,30)/p+1/t5-,6+,11+,15+,20+/m0/s1 |
| InChIKey | UNHNEQBVOGPLPC-NJGCYRJQSA-O |
| XLogP | -0.13 |
| TPSA | 221.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|