C26H29NO9 — CID 54722346
1,5,10,11,12a-pentahydroxy-6-methyl-7-(4-methyl-2-oxopentyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722346) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is 1,5,10,11,12a-pentahydroxy-6-methyl-7-(4-methyl-2-oxopentyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,5,10,11,12a-pentahydroxy-6-methyl-7-(4-methyl-2-oxopentyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722346 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1,5,10,11,12a-pentahydroxy-6-methyl-7-(4-methyl-2-oxopentyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)CC(=O)Cc1ccc(O)c2c1C(C)C1C(=C2O)C(=O)C2(O)C(O)=C(C(N)=O)C(=O)CC2C1O |
| InChI | InChI=1S/C26H29NO9/c1-9(2)6-12(28)7-11-4-5-14(29)18-16(11)10(3)17-20(22(18)32)24(34)26(36)13(21(17)31)8-15(30)19(23(26)33)25(27)35/h4-5,9-10,13,17,21,29,31-33,36H,6-8H2,1-3H3,(H2,27,35) |
| InChIKey | OQOVSYIEBDUYTC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|