C20H19N3O10 — CID 54725380
(4aR,5aR,12aR)-7-amino-1,5,10,11,12a-pentahydroxy-6-methyl-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54725380) has the molecular formula C20H19N3O10 and a molecular weight of 461.38 g/mol. Its IUPAC name is (4aR,5aR,12aR)-7-amino-1,5,10,11,12a-pentahydroxy-6-methyl-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5aR,12aR)-7-amino-1,5,10,11,12a-pentahydroxy-6-methyl-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54725380 |
| Molecular Formula | C20H19N3O10 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (4aR,5aR,12aR)-7-amino-1,5,10,11,12a-pentahydroxy-6-methyl-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2c(N)cc([N+](=O)[O-])c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C(O)[C@@H]21 |
| InChI | InChI=1S/C20H19N3O10/c1-4-9-6(21)3-7(23(32)33)15(26)12(9)16(27)13-10(4)14(25)5-2-8(24)11(19(22)30)17(28)20(5,31)18(13)29/h3-5,10,14,25-28,31H,2,21H2,1H3,(H2,22,30)/t4?,5-,10-,14?,20-/m1/s1 |
| InChIKey | SQXONNPGOFYXFF-BYLRSMHZSA-N |
| XLogP | -0.55 |
| TPSA | 247.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|