C21H20N2O9 — CID 54716054
(4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide (PubChem CID 54716054) has the molecular formula C21H20N2O9 and a molecular weight of 444.40 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide |
|---|---|
| PubChem CID | 54716054 |
| Molecular Formula | C21H20N2O9 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide |
| SMILES | C[C@H]1c2ccc(C(N)=O)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C21H20N2O9/c1-5-6-2-3-7(19(22)30)14(25)11(6)16(27)13-10(5)15(26)8-4-9(24)12(20(23)31)17(28)21(8,32)18(13)29/h2-3,5,8,10,15,25-28,32H,4H2,1H3,(H2,22,30)(H2,23,31)/t5-,8+,10+,15+,21+/m0/s1 |
| InChIKey | QSUMTSKNNMKZCH-RRDRDPTPSA-N |
| XLogP | -0.95 |
| TPSA | 221.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|