C30H37NO8 — CID 54722338
1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(4-propylcyclohexyl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722338) has the molecular formula C30H37NO8 and a molecular weight of 539.63 g/mol. Its IUPAC name is 1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(4-propylcyclohexyl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(4-propylcyclohexyl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722338 |
| Molecular Formula | C30H37NO8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(4-propylcyclohexyl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCC1CCC(Cc2ccc3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)CC4C(O)C2C3C)CC1 |
| InChI | InChI=1S/C30H37NO8/c1-3-4-14-5-7-15(8-6-14)11-16-9-10-17-13(2)20-23(26(35)21(17)24(16)33)28(37)30(39)18(25(20)34)12-19(32)22(27(30)36)29(31)38/h9-10,13-15,18,20,25,33-36,39H,3-8,11-12H2,1-2H3,(H2,31,38) |
| InChIKey | CHOCDDXZIAULNI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|