C28H26N2O9 — CID 54722939
9-(benzamidomethyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722939) has the molecular formula C28H26N2O9 and a molecular weight of 534.52 g/mol. Its IUPAC name is 9-(benzamidomethyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(benzamidomethyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722939 |
| Molecular Formula | C28H26N2O9 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 9-(benzamidomethyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(CNC(=O)c3ccccc3)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C21 |
| InChI | InChI=1S/C28H26N2O9/c1-11-14-8-7-13(10-30-27(38)12-5-3-2-4-6-12)21(32)18(14)23(34)20-17(11)22(33)15-9-16(31)19(26(29)37)24(35)28(15,39)25(20)36/h2-8,11,15,17,22,32-35,39H,9-10H2,1H3,(H2,29,37)(H,30,38) |
| InChIKey | RTKXJCLQHKHNSS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|