C31H35N2O11P — CID 58648224
(4aR,5S,5aR,6R,12aR)-9-[[diethoxyphosphoryl(phenyl)methyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648224) has the molecular formula C31H35N2O11P and a molecular weight of 642.60 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-9-[[diethoxyphosphoryl(phenyl)methyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-9-[[diethoxyphosphoryl(phenyl)methyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648224 |
| Molecular Formula | C31H35N2O11P |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-9-[[diethoxyphosphoryl(phenyl)methyl]amino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]1[C@H]2C)c1ccccc1 |
| InChI | InChI=1S/C31H35N2O11P/c1-4-43-45(42,44-5-2)30(15-9-7-6-8-10-15)33-18-12-11-16-14(3)20-23(26(37)21(16)25(18)36)28(39)31(41)17(24(20)35)13-19(34)22(27(31)38)29(32)40/h6-12,14,17,20,24,30,33,35-38,41H,4-5,13H2,1-3H3,(H2,32,40)/t14-,17+,20+,24+,30?,31+/m0/s1 |
| InChIKey | HENQATMMJUUYCD-JZUCUMSASA-N |
| XLogP | 3.33 |
| TPSA | 225.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|