C27H24FN3O9 — CID 140505660
(4aR,5S,5aR,6R,12aR)-9-[(4-fluorophenyl)carbamoylamino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505660) has the molecular formula C27H24FN3O9 and a molecular weight of 553.50 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-9-[(4-fluorophenyl)carbamoylamino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-9-[(4-fluorophenyl)carbamoylamino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505660 |
| Molecular Formula | C27H24FN3O9 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-9-[(4-fluorophenyl)carbamoylamino]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(NC(=O)Nc3ccc(F)cc3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C27H24FN3O9/c1-9-12-6-7-14(31-26(39)30-11-4-2-10(28)3-5-11)21(34)17(12)22(35)19-16(9)20(33)13-8-15(32)18(25(29)38)23(36)27(13,40)24(19)37/h2-7,9,13,16,20,33-36,40H,8H2,1H3,(H2,29,38)(H2,30,31,39)/t9-,13+,16+,20+,27+/m0/s1 |
| InChIKey | IHONIDRQWPQVOC-JQOFPHRMSA-N |
| XLogP | 1.74 |
| TPSA | 219.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|