C34H31N3O10 — CID 58627620
[(4aR,5S,5aR,6R,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-9-(naphthalen-1-ylcarbamoylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 58627620) has the molecular formula C34H31N3O10 and a molecular weight of 641.63 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-9-(naphthalen-1-ylcarbamoylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-9-(naphthalen-1-ylcarbamoylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 58627620 |
| Molecular Formula | C34H31N3O10 |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-9-(naphthalen-1-ylcarbamoylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H]2C(=C(O)c3c(ccc(NC(=O)Nc4cccc5ccccc45)c3O)[C@@H]2C)C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C34H31N3O10/c1-3-22(39)47-29-18-13-21(38)25(32(35)44)30(42)34(18,46)31(43)26-23(29)14(2)16-11-12-20(27(40)24(16)28(26)41)37-33(45)36-19-10-6-8-15-7-4-5-9-17(15)19/h4-12,14,18,23,29,40-42,46H,3,13H2,1-2H3,(H2,35,44)(H2,36,37,45)/t14-,18+,23+,29+,34+/m0/s1 |
| InChIKey | YNYIWIQBMUVUNZ-PNCFGRQWSA-N |
| XLogP | 3.71 |
| TPSA | 225.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|