C25H26N2O9 — CID 58627665
[(4aR,5S,5aR,6R,12aR)-2-carbamoyl-9-(ethenylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 58627665) has the molecular formula C25H26N2O9 and a molecular weight of 498.49 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-9-(ethenylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-9-(ethenylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 58627665 |
| Molecular Formula | C25H26N2O9 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aR)-2-carbamoyl-9-(ethenylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | C=CNc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](OC(=O)CC)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C25H26N2O9/c1-4-14(29)36-21-11-8-13(28)17(24(26)34)22(32)25(11,35)23(33)18-15(21)9(3)10-6-7-12(27-5-2)19(30)16(10)20(18)31/h5-7,9,11,15,21,27,30-32,35H,2,4,8H2,1,3H3,(H2,26,34)/t9-,11+,15+,21+,25+/m0/s1 |
| InChIKey | WMCUUGWXCHGOJH-IXKYXSERSA-N |
| XLogP | 1.47 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|