C28H25NO9 — CID 54698393
(2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl) 2-phenylacetate (PubChem CID 54698393) has the molecular formula C28H25NO9 and a molecular weight of 519.51 g/mol. Its IUPAC name is (2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl) 2-phenylacetate.
| Compound Name | (2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl) 2-phenylacetate |
|---|---|
| PubChem CID | 54698393 |
| Molecular Formula | C28H25NO9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (2-carbamoyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl) 2-phenylacetate |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(OC(=O)Cc3ccccc3)C21 |
| InChI | InChI=1S/C28H25NO9/c1-12-14-8-5-9-16(30)20(14)23(33)22-19(12)24(38-18(32)10-13-6-3-2-4-7-13)15-11-17(31)21(27(29)36)25(34)28(15,37)26(22)35/h2-9,12,15,19,24,30,33-34,37H,10-11H2,1H3,(H2,29,36) |
| InChIKey | AVUHQUZXFLSKEU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|