C22H23NO8 — CID 140506087
(4aR,5S,5aR,6R,12aR)-1,10,11-trihydroxy-5,12a-dimethoxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140506087) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,10,11-trihydroxy-5,12a-dimethoxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,10,11-trihydroxy-5,12a-dimethoxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506087 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,10,11-trihydroxy-5,12a-dimethoxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CO[C@H]1[C@H]2C(=C(O)c3c(O)cccc3[C@@H]2C)C(=O)[C@]2(OC)C(O)=C(C(N)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C22H23NO8/c1-8-9-5-4-6-11(24)14(9)17(26)16-13(8)18(30-2)10-7-12(25)15(21(23)29)19(27)22(10,31-3)20(16)28/h4-6,8,10,13,18,24,26-27H,7H2,1-3H3,(H2,23,29)/t8-,10+,13+,18+,22+/m0/s1 |
| InChIKey | IQWSQBXFSOGZNB-FGHFVKOTSA-N |
| XLogP | 1.26 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|