C27H31NO9 — CID 140505892
(4aR,5S,5aR,12aR)-6-(cyclopentyloxymethyl)-1,10,11,12a-tetrahydroxy-5-(methoxymethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505892) has the molecular formula C27H31NO9 and a molecular weight of 513.54 g/mol. Its IUPAC name is (4aR,5S,5aR,12aR)-6-(cyclopentyloxymethyl)-1,10,11,12a-tetrahydroxy-5-(methoxymethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aR)-6-(cyclopentyloxymethyl)-1,10,11,12a-tetrahydroxy-5-(methoxymethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505892 |
| Molecular Formula | C27H31NO9 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (4aR,5S,5aR,12aR)-6-(cyclopentyloxymethyl)-1,10,11,12a-tetrahydroxy-5-(methoxymethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COC[C@@H]1[C@H]2CC(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C2=C(O)c3c(O)cccc3C(COC3CCCC3)[C@H]21 |
| InChI | InChI=1S/C27H31NO9/c1-36-10-15-16-9-18(30)21(26(28)34)24(32)27(16,35)25(33)22-19(15)14(11-37-12-5-2-3-6-12)13-7-4-8-17(29)20(13)23(22)31/h4,7-8,12,14-16,19,29,31-32,35H,2-3,5-6,9-11H2,1H3,(H2,28,34)/t14?,15-,16-,19+,27-/m1/s1 |
| InChIKey | BJLZPIQGEWMHOE-GIKASJIWSA-N |
| XLogP | 1.80 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|