C24H28N2O8S — CID 54722424
6-[2-(dimethylamino)ethylsulfanylmethyl]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722424) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylsulfanylmethyl]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 6-[2-(dimethylamino)ethylsulfanylmethyl]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722424 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 6-[2-(dimethylamino)ethylsulfanylmethyl]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)CCSCC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C21 |
| InChI | InChI=1S/C24H28N2O8S/c1-26(2)6-7-35-9-11-10-4-3-5-13(27)15(10)20(30)18-16(11)19(29)12-8-14(28)17(23(25)33)21(31)24(12,34)22(18)32/h3-5,11-12,16,19,27,29-31,34H,6-9H2,1-2H3,(H2,25,33) |
| InChIKey | VGSXDMBIIZBUKW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|