C23H23NO9 — CID 58648130
(4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-7-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648130) has the molecular formula C23H23NO9 and a molecular weight of 457.44 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-7-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-7-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648130 |
| Molecular Formula | C23H23NO9 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-7-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Cc1ccc(O)c2c1[C@H](C)[C@@H]1C(=C2O)C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)C[C@@H]2[C@H]1O |
| InChI | InChI=1S/C23H23NO9/c1-7(25)5-9-3-4-11(26)15-13(9)8(2)14-17(19(15)29)21(31)23(33)10(18(14)28)6-12(27)16(20(23)30)22(24)32/h3-4,8,10,14,18,26,28-30,33H,5-6H2,1-2H3,(H2,24,32)/t8-,10+,14+,18+,23+/m0/s1 |
| InChIKey | ZKQOQEMBDLQSMJ-FYGCRJDGSA-N |
| XLogP | 0.09 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|