C22H22O8 — CID 58648191
(4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7,12-pentahydroxy-10,11-dimethyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 58648191) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7,12-pentahydroxy-10,11-dimethyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7,12-pentahydroxy-10,11-dimethyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 58648191 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7,12-pentahydroxy-10,11-dimethyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C)c4[C@H](C)[C@H]3[C@H](O)[C@H]2CC1=O |
| InChI | InChI=1S/C22H22O8/c1-7-4-5-11(24)16-13(7)8(2)14-17(19(16)27)21(29)22(30)10(18(14)26)6-12(25)15(9(3)23)20(22)28/h4-5,8,10,14,18,24,26-28,30H,6H2,1-3H3/t8-,10+,14+,18+,22+/m0/s1 |
| InChIKey | ZBBBDBPRZBFGDC-UHJKJQAISA-N |
| XLogP | 1.37 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|