C27H23FO8 — CID 118015056
3-acetyl-8-(4-fluorophenyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 118015056) has the molecular formula C27H23FO8 and a molecular weight of 494.47 g/mol. Its IUPAC name is 3-acetyl-8-(4-fluorophenyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | 3-acetyl-8-(4-fluorophenyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 118015056 |
| Molecular Formula | C27H23FO8 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-acetyl-8-(4-fluorophenyl)-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(ccc(-c5ccc(F)cc5)c4O)C(C)C3C(O)C2CC1=O |
| InChI | InChI=1S/C27H23FO8/c1-10-14-7-8-15(12-3-5-13(28)6-4-12)22(31)20(14)24(33)21-18(10)23(32)16-9-17(30)19(11(2)29)25(34)27(16,36)26(21)35/h3-8,10,16,18,23,31-34,36H,9H2,1-2H3 |
| InChIKey | LLSCAXKAIJCUJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|