C28H33NO10 — CID 54722393
[4-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)-4-methylpentyl] acetate (PubChem CID 54722393) has the molecular formula C28H33NO10 and a molecular weight of 543.57 g/mol. Its IUPAC name is [4-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)-4-methylpentyl] acetate.
| Compound Name | [4-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)-4-methylpentyl] acetate |
|---|---|
| PubChem CID | 54722393 |
| Molecular Formula | C28H33NO10 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | [4-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)-4-methylpentyl] acetate |
| SMILES | CC(=O)OCCCC(C)(C)c1ccc2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C1C2C |
| InChI | InChI=1S/C28H33NO10/c1-11-13-6-7-14(27(3,4)8-5-9-39-12(2)30)21(32)18(13)23(34)20-17(11)22(33)15-10-16(31)19(26(29)37)24(35)28(15,38)25(20)36/h6-7,11,15,17,22,32-35,38H,5,8-10H2,1-4H3,(H2,29,37) |
| InChIKey | HNTSECKHTMPPQJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|