C28H35NO8 — CID 140506143
(4aR,5S,5aR,12aR)-9-(2,6-dimethylheptan-2-yl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140506143) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is (4aR,5S,5aR,12aR)-9-(2,6-dimethylheptan-2-yl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aR)-9-(2,6-dimethylheptan-2-yl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506143 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (4aR,5S,5aR,12aR)-9-(2,6-dimethylheptan-2-yl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)CCCC(C)(C)c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C28H35NO8/c1-12(2)6-5-9-27(3,4)15-8-7-13-10-14-19(23(33)18(13)22(15)32)24(34)28(37)16(21(14)31)11-17(30)20(25(28)35)26(29)36/h7-8,12,14,16,21,31-33,35,37H,5-6,9-11H2,1-4H3,(H2,29,36)/t14-,16-,21+,28+/m1/s1 |
| InChIKey | NZBAFSLGRLMCOI-KVNHRXRASA-N |
| XLogP | 2.50 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|