C22H20N2O8 — CID 140505822
(4aR,5S,5aR,12aR)-9-(2-cyanoethyl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505822) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is (4aR,5S,5aR,12aR)-9-(2-cyanoethyl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aR)-9-(2-cyanoethyl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505822 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (4aR,5S,5aR,12aR)-9-(2-cyanoethyl)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | N#CCCc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C22H20N2O8/c23-5-1-2-8-3-4-9-6-10-14(18(28)13(9)16(8)26)19(29)22(32)11(17(10)27)7-12(25)15(20(22)30)21(24)31/h3-4,10-11,17,26-28,30,32H,1-2,6-7H2,(H2,24,31)/t10-,11-,17+,22+/m1/s1 |
| InChIKey | HEOAJHBYYGLSNA-JNCGSSSGSA-N |
| XLogP | -0.15 |
| TPSA | 202.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|